C30H45F2N3O6Si2 — CID 66602441
2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(methoxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602441) has the molecular formula C30H45F2N3O6Si2 and a molecular weight of 637.87 g/mol. Its IUPAC name is 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(methoxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(methoxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602441 |
| Molecular Formula | C30H45F2N3O6Si2 |
| Molecular Weight | 637.87 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(methoxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | COCc1c(-c2ccc(OC(F)F)c(OC3CC3)c2)n(COCC[Si](C)(C)C)c2cnn(COCC[Si](C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C30H45F2N3O6Si2/c1-37-18-23-27-24(17-33-35(29(27)36)20-39-13-15-43(5,6)7)34(19-38-12-14-42(2,3)4)28(23)21-8-11-25(41-30(31)32)26(16-21)40-22-9-10-22/h8,11,16-17,22,30H,9-10,12-15,18-20H2,1-7H3 |
| InChIKey | HGVMTYJWRGPZSD-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 85.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.87 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|