C22H27F2N3O4Si — CID 66602461
2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602461) has the molecular formula C22H27F2N3O4Si and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602461 |
| Molecular Formula | C22H27F2N3O4Si |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(OC(F)F)c(OC3CC3)c2)cc2c(=O)[nH]ncc21 |
| InChI | InChI=1S/C22H27F2N3O4Si/c1-32(2,3)9-8-29-13-27-17(11-16-18(27)12-25-26-21(16)28)14-4-7-19(31-22(23)24)20(10-14)30-15-5-6-15/h4,7,10-12,15,22H,5-6,8-9,13H2,1-3H3,(H,26,28) |
| InChIKey | BZMSSLQTCBSJSY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|