C34H51F2N3O5Si2 — CID 66602473
2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-[(E)-hex-1-enyl]-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602473) has the molecular formula C34H51F2N3O5Si2 and a molecular weight of 675.97 g/mol. Its IUPAC name is 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-[(E)-hex-1-enyl]-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-[(E)-hex-1-enyl]-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602473 |
| Molecular Formula | C34H51F2N3O5Si2 |
| Molecular Weight | 675.97 g/mol |
| Exact Mass | 675.33 |
| IUPAC Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-[(E)-hex-1-enyl]-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | CCCC/C=C/c1c(-c2ccc(OC(F)F)c(OC3CC3)c2)n(COCC[Si](C)(C)C)c2cnn(COCC[Si](C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C34H51F2N3O5Si2/c1-8-9-10-11-12-27-31-28(22-37-39(33(31)40)24-42-18-20-46(5,6)7)38(23-41-17-19-45(2,3)4)32(27)25-13-16-29(44-34(35)36)30(21-25)43-26-14-15-26/h11-13,16,21-22,26,34H,8-10,14-15,17-20,23-24H2,1-7H3/b12-11+ |
| InChIKey | TWLWRDGJAHRILW-VAWYXSNFSA-N |
| XLogP | 8.84 |
| TPSA | 76.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.97 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|