C23H40BrN3O4Si2 — CID 66602614
2-bromo-3-(cyclobutyloxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602614) has the molecular formula C23H40BrN3O4Si2 and a molecular weight of 558.67 g/mol. Its IUPAC name is 2-bromo-3-(cyclobutyloxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-bromo-3-(cyclobutyloxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602614 |
| Molecular Formula | C23H40BrN3O4Si2 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 2-bromo-3-(cyclobutyloxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(c(COC3CCC3)c(Br)n2COCC[Si](C)(C)C)c1=O |
| InChI | InChI=1S/C23H40BrN3O4Si2/c1-32(2,3)12-10-29-16-26-20-14-25-27(17-30-11-13-33(4,5)6)23(28)21(20)19(22(26)24)15-31-18-8-7-9-18/h14,18H,7-13,15-17H2,1-6H3 |
| InChIKey | DQLATAFPOFCOBN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|