About 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile
3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile (PubChem CID 66602796) has the molecular formula C20H19N2O2+
and a molecular weight of 319.38 g/mol. Its IUPAC name is 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile |
| PubChem CID | 66602796 |
| Molecular Formula | C20H19N2O2+ |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile |
| SMILES | Cc1c2cc(CO)c(CO)cc2cc(-c2cccc(C#N)c2)[n+]1C |
| InChI | InChI=1S/C20H19N2O2/c1-13-19-8-18(12-24)17(11-23)7-16(19)9-20(22(13)2)15-5-3-4-14(6-15)10-21/h3-9,23-24H,11-12H2,1-2H3/q+1 |
| InChIKey | UCFDRZBTJOCTBP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile?
The IUPAC name of 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile (CID 66602796) is 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile.
What is the SMILES notation for 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile?
The canonical SMILES for 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile is Cc1c2cc(CO)c(CO)cc2cc(-c2cccc(C#N)c2)[n+]1C.
What is the InChIKey of 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile?
The InChIKey is UCFDRZBTJOCTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N2O2/c1-13-19-8-18(12-24)17(11-23)7-16(19)9-20(22(13)2)15-5-3-4-14(6-15)10-21/h3-9,23-24H,11-12H2,1-2H3/q+1.
What are the key properties of 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile?
3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile has a molecular weight of 319.38 g/mol, XLogP of 2.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6,7-bis(hydroxymethyl)-1,2-dimethylisoquinolin-2-ium-3-yl]benzonitrile is sourced from PubChem (CID 66602796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).