C7H10N4 — CID 66603013
5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine (PubChem CID 66603013) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is 5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66603013 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1CNCC2 |
| InChI | InChI=1S/C7H10N4/c8-7-5-3-9-2-1-6(5)10-4-11-7/h4,9H,1-3H2,(H2,8,10,11) |
| InChIKey | JVGPRASOJVWZHF-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |