About CID 66603050
CID 66603050 (PubChem CID 66603050) has the molecular formula C5H9NNaO
and a molecular weight of 122.12 g/mol.
Molecular Properties
| Compound Name | CID 66603050 |
| PubChem CID | 66603050 |
| Molecular Formula | C5H9NNaO |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | — |
| SMILES | CC1CNC(=O)C1.[Na] |
| InChI | InChI=1S/C5H9NO.Na/c1-4-2-5(7)6-3-4;/h4H,2-3H2,1H3,(H,6,7); |
| InChIKey | UARKGMGDAIZMGW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 66603050 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66603050?
The IUPAC name of CID 66603050 (CID 66603050) is not available.
What is the SMILES notation for CID 66603050?
The canonical SMILES for CID 66603050 is CC1CNC(=O)C1.[Na].
What is the InChIKey of CID 66603050?
The InChIKey is UARKGMGDAIZMGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.Na/c1-4-2-5(7)6-3-4;/h4H,2-3H2,1H3,(H,6,7);.
What are the key properties of CID 66603050?
CID 66603050 has a molecular weight of 122.12 g/mol, XLogP of -0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66603050 is sourced from PubChem (CID 66603050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).