C27H26ClF3N4O2 — CID 66603160
1-(10-methyl-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indol-8-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one;hydrochloride (PubChem CID 66603160) has the molecular formula C27H26ClF3N4O2 and a molecular weight of 530.98 g/mol. Its IUPAC name is 1-(10-methyl-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indol-8-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one;hydrochloride.
| Compound Name | 1-(10-methyl-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indol-8-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 66603160 |
| Molecular Formula | C27H26ClF3N4O2 |
| Molecular Weight | 530.98 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 1-(10-methyl-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indol-8-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one;hydrochloride |
| SMILES | Cl.Cn1c2c(c3ccc(-n4ccc(OCc5ccc(C(F)(F)F)nc5)cc4=O)cc31)CN1CCCC1C2 |
| InChI | InChI=1S/C27H25F3N4O2.ClH/c1-32-23-12-19(5-6-21(23)22-15-33-9-2-3-18(33)11-24(22)32)34-10-8-20(13-26(34)35)36-16-17-4-7-25(31-14-17)27(28,29)30;/h4-8,10,12-14,18H,2-3,9,11,15-16H2,1H3;1H |
| InChIKey | RPCVVPMPULURFG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.98 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|