C20H40N2Si2 — CID 66603263
1-N,2-N-diethyl-1-N-[3-[ethyl(dimethyl)silyl]propyl]-2-N-trimethylsilylbenzene-1,2-diamine (PubChem CID 66603263) has the molecular formula C20H40N2Si2 and a molecular weight of 364.73 g/mol. Its IUPAC name is 1-N,2-N-diethyl-1-N-[3-[ethyl(dimethyl)silyl]propyl]-2-N-trimethylsilylbenzene-1,2-diamine.
| Compound Name | 1-N,2-N-diethyl-1-N-[3-[ethyl(dimethyl)silyl]propyl]-2-N-trimethylsilylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 66603263 |
| Molecular Formula | C20H40N2Si2 |
| Molecular Weight | 364.73 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 1-N,2-N-diethyl-1-N-[3-[ethyl(dimethyl)silyl]propyl]-2-N-trimethylsilylbenzene-1,2-diamine |
| SMILES | CCN(CCC[Si](C)(C)CC)c1ccccc1N(CC)[Si](C)(C)C |
| InChI | InChI=1S/C20H40N2Si2/c1-9-21(17-14-18-24(7,8)11-3)19-15-12-13-16-20(19)22(10-2)23(4,5)6/h12-13,15-16H,9-11,14,17-18H2,1-8H3 |
| InChIKey | GUKCYJVSFITRMY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.73 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|