C25H22F3N5O — CID 66603270
1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one (PubChem CID 66603270) has the molecular formula C25H22F3N5O and a molecular weight of 465.48 g/mol. Its IUPAC name is 1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one.
| Compound Name | 1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one |
|---|---|
| PubChem CID | 66603270 |
| Molecular Formula | C25H22F3N5O |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1-(8-methyl-6,8,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-5-yl)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(-c5ccc(C(F)(F)F)nc5)cc4=O)nc31)CN1CCCC1C2 |
| InChI | InChI=1S/C25H22F3N5O/c1-31-20-12-17-3-2-9-32(17)14-19(20)18-5-7-22(30-24(18)31)33-10-8-15(11-23(33)34)16-4-6-21(29-13-16)25(26,27)28/h4-8,10-11,13,17H,2-3,9,12,14H2,1H3 |
| InChIKey | CHMUYYMSJMHMJC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |