C25H26F3NO2S — CID 66603347
[2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 5,5,5-trifluoro-2-methylpentanoate (PubChem CID 66603347) has the molecular formula C25H26F3NO2S and a molecular weight of 461.55 g/mol. Its IUPAC name is [2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 5,5,5-trifluoro-2-methylpentanoate.
| Compound Name | [2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 5,5,5-trifluoro-2-methylpentanoate |
|---|---|
| PubChem CID | 66603347 |
| Molecular Formula | C25H26F3NO2S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 5,5,5-trifluoro-2-methylpentanoate |
| SMILES | Cc1ccc(-c2c(OC(=O)C(C)CCC(F)(F)F)c(C)nc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C25H26F3NO2S/c1-14-8-10-17(11-9-14)20-21-18-6-4-5-7-19(18)32-23(21)29-16(3)22(20)31-24(30)15(2)12-13-25(26,27)28/h8-11,15H,4-7,12-13H2,1-3H3 |
| InChIKey | GUHYTGBSGMHQBO-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |