C27H33NO2S — CID 66603708
[2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 2,4,4-trimethylpentanoate (PubChem CID 66603708) has the molecular formula C27H33NO2S and a molecular weight of 435.63 g/mol. Its IUPAC name is [2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 2,4,4-trimethylpentanoate.
| Compound Name | [2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 66603708 |
| Molecular Formula | C27H33NO2S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 2,4,4-trimethylpentanoate |
| SMILES | Cc1ccc(-c2c(OC(=O)C(C)CC(C)(C)C)c(C)nc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C27H33NO2S/c1-16-11-13-19(14-12-16)22-23-20-9-7-8-10-21(20)31-25(23)28-18(3)24(22)30-26(29)17(2)15-27(4,5)6/h11-14,17H,7-10,15H2,1-6H3 |
| InChIKey | JNZHVOQIPJGSQR-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |