C28H30F2N4O3 — CID 66603789
5-[4-[8-(3,4-difluorophenyl)-8-(2-methylbutoxy)-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-2-methoxyphenyl]-2-methyl-1,3-oxazole (PubChem CID 66603789) has the molecular formula C28H30F2N4O3 and a molecular weight of 508.57 g/mol. Its IUPAC name is 5-[4-[8-(3,4-difluorophenyl)-8-(2-methylbutoxy)-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-2-methoxyphenyl]-2-methyl-1,3-oxazole.
| Compound Name | 5-[4-[8-(3,4-difluorophenyl)-8-(2-methylbutoxy)-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-2-methoxyphenyl]-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 66603789 |
| Molecular Formula | C28H30F2N4O3 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 5-[4-[8-(3,4-difluorophenyl)-8-(2-methylbutoxy)-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-2-methoxyphenyl]-2-methyl-1,3-oxazole |
| SMILES | CCC(C)COC1(c2ccc(F)c(F)c2)CCCn2c(-c3ccc(-c4cnc(C)o4)c(OC)c3)nnc21 |
| InChI | InChI=1S/C28H30F2N4O3/c1-5-17(2)16-36-28(20-8-10-22(29)23(30)14-20)11-6-12-34-26(32-33-27(28)34)19-7-9-21(24(13-19)35-4)25-15-31-18(3)37-25/h7-10,13-15,17H,5-6,11-12,16H2,1-4H3 |
| InChIKey | HLUVSOBECXBGCC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 75.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |