About hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate
hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate (PubChem CID 66604631) has the molecular formula C10H13NO4S
and a molecular weight of 243.28 g/mol. Its IUPAC name is hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate.
Molecular Properties
| Compound Name | hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate |
| PubChem CID | 66604631 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate |
| SMILES | C[N+]1=Cc2ccccc2CC1.O=S(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C10H12N.H2O4S/c1-11-7-6-9-4-2-3-5-10(9)8-11;1-5(2,3)4/h2-5,8H,6-7H2,1H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | SUHSAFFQBFAYEP-UHFFFAOYSA-M |
| XLogP | 0.08 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate?
The IUPAC name of hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate (CID 66604631) is hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate.
What is the SMILES notation for hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate?
The canonical SMILES for hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate is C[N+]1=Cc2ccccc2CC1.O=S(=O)([O-])[O-].[H+].
What is the InChIKey of hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate?
The InChIKey is SUHSAFFQBFAYEP-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H12N.H2O4S/c1-11-7-6-9-4-2-3-5-10(9)8-11;1-5(2,3)4/h2-5,8H,6-7H2,1H3;(H2,1,2,3,4)/q+1;/p-1.
What are the key properties of hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate?
hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate has a molecular weight of 243.28 g/mol, XLogP of 0.08, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-methyl-3,4-dihydroisoquinolin-2-ium;sulfate is sourced from PubChem (CID 66604631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).