About methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate
methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate (PubChem CID 66604900) has the molecular formula C19H14N2O3
and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate |
| PubChem CID | 66604900 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)[nH]c2c1[nH]c1cccc(=O)c12 |
| InChI | InChI=1S/C19H14N2O3/c1-24-19(23)12-10-14(11-6-3-2-4-7-11)21-18-16-13(20-17(12)18)8-5-9-15(16)22/h2-10,20-21H,1H3 |
| InChIKey | OLLQRGNUSPOELC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate?
The IUPAC name of methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate (CID 66604900) is methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate.
What is the SMILES notation for methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate?
The canonical SMILES for methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate is COC(=O)c1cc(-c2ccccc2)[nH]c2c1[nH]c1cccc(=O)c12.
What is the InChIKey of methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate?
The InChIKey is OLLQRGNUSPOELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O3/c1-24-19(23)12-10-14(11-6-3-2-4-7-11)21-18-16-13(20-17(12)18)8-5-9-15(16)22/h2-10,20-21H,1H3.
What are the key properties of methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate?
methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate has a molecular weight of 318.33 g/mol, XLogP of 3.46, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-oxo-2-phenyl-1,5-dihydropyrido[3,2-b]indole-4-carboxylate is sourced from PubChem (CID 66604900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).