C22H16Cl2N2O2 — CID 66604928
ethyl 4-[2-cyano-4-(3,4-dichlorophenyl)anilino]benzoate (PubChem CID 66604928) has the molecular formula C22H16Cl2N2O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is ethyl 4-[2-cyano-4-(3,4-dichlorophenyl)anilino]benzoate.
| Compound Name | ethyl 4-[2-cyano-4-(3,4-dichlorophenyl)anilino]benzoate |
|---|---|
| PubChem CID | 66604928 |
| Molecular Formula | C22H16Cl2N2O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | ethyl 4-[2-cyano-4-(3,4-dichlorophenyl)anilino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ccc(-c3ccc(Cl)c(Cl)c3)cc2C#N)cc1 |
| InChI | InChI=1S/C22H16Cl2N2O2/c1-2-28-22(27)14-3-7-18(8-4-14)26-21-10-6-15(11-17(21)13-25)16-5-9-19(23)20(24)12-16/h3-12,26H,2H2,1H3 |
| InChIKey | WJLIBTHAKRKXCV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |