About 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide
2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide (PubChem CID 66604983) has the molecular formula C23H22ClN5O
and a molecular weight of 419.92 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide |
| PubChem CID | 66604983 |
| Molecular Formula | C23H22ClN5O |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide |
| SMILES | CN1CCN(c2ccc3c(c2)[nH]c2c(C(N)=O)cc(-c4cccc(Cl)c4)nc23)CC1 |
| InChI | InChI=1S/C23H22ClN5O/c1-28-7-9-29(10-8-28)16-5-6-17-20(12-16)27-22-18(23(25)30)13-19(26-21(17)22)14-3-2-4-15(24)11-14/h2-6,11-13,27H,7-10H2,1H3,(H2,25,30) |
| InChIKey | XRWPJVNMVYEAEJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide?
The IUPAC name of 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide (CID 66604983) is 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide.
What is the SMILES notation for 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide?
The canonical SMILES for 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide is CN1CCN(c2ccc3c(c2)[nH]c2c(C(N)=O)cc(-c4cccc(Cl)c4)nc23)CC1.
What is the InChIKey of 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide?
The InChIKey is XRWPJVNMVYEAEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClN5O/c1-28-7-9-29(10-8-28)16-5-6-17-20(12-16)27-22-18(23(25)30)13-19(26-21(17)22)14-3-2-4-15(24)11-14/h2-6,11-13,27H,7-10H2,1H3,(H2,25,30).
What are the key properties of 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide?
2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide has a molecular weight of 419.92 g/mol, XLogP of 3.89, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-7-(4-methylpiperazin-1-yl)-5H-pyrido[3,2-b]indole-4-carboxamide is sourced from PubChem (CID 66604983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).