C29H29ClFNO7S — CID 66606227
[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-chloro-3-[[5-(5-fluoro-2-pyridinyl)thiophen-2-yl]methyl]phenyl]-2-ethyloxan-3-yl] acetate (PubChem CID 66606227) has the molecular formula C29H29ClFNO7S and a molecular weight of 590.07 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-chloro-3-[[5-(5-fluoro-2-pyridinyl)thiophen-2-yl]methyl]phenyl]-2-ethyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-chloro-3-[[5-(5-fluoro-2-pyridinyl)thiophen-2-yl]methyl]phenyl]-2-ethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 66606227 |
| Molecular Formula | C29H29ClFNO7S |
| Molecular Weight | 590.07 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-chloro-3-[[5-(5-fluoro-2-pyridinyl)thiophen-2-yl]methyl]phenyl]-2-ethyloxan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(-c4ccc(F)cn4)s3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H29ClFNO7S/c1-5-24-27(36-15(2)33)29(38-17(4)35)28(37-16(3)34)26(39-24)18-6-9-22(30)19(12-18)13-21-8-11-25(40-21)23-10-7-20(31)14-32-23/h6-12,14,24,26-29H,5,13H2,1-4H3/t24-,26+,27-,28+,29+/m1/s1 |
| InChIKey | CNGORQKVOJUAFV-GLOKNNJPSA-N |
| XLogP | 5.84 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.07 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|