About 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide
1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide (PubChem CID 666064) has the molecular formula C15H20N6O2
and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide |
| PubChem CID | 666064 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(C)nc(N(C#N)CC(=O)N2CCC(C(N)=O)CC2)n1 |
| InChI | InChI=1S/C15H20N6O2/c1-10-7-11(2)19-15(18-10)21(9-16)8-13(22)20-5-3-12(4-6-20)14(17)23/h7,12H,3-6,8H2,1-2H3,(H2,17,23) |
| InChIKey | PWYSHXWZNMUGTR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide?
The IUPAC name of 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide (CID 666064) is 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide is Cc1cc(C)nc(N(C#N)CC(=O)N2CCC(C(N)=O)CC2)n1.
What is the InChIKey of 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide?
The InChIKey is PWYSHXWZNMUGTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6O2/c1-10-7-11(2)19-15(18-10)21(9-16)8-13(22)20-5-3-12(4-6-20)14(17)23/h7,12H,3-6,8H2,1-2H3,(H2,17,23).
What are the key properties of 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide?
1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide has a molecular weight of 316.37 g/mol, XLogP of 0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]acetyl]piperidine-4-carboxamide is sourced from PubChem (CID 666064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).