C21H24BNO3 — CID 66606460
2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-isoindol-1-one (PubChem CID 66606460) has the molecular formula C21H24BNO3 and a molecular weight of 349.24 g/mol. Its IUPAC name is 2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-isoindol-1-one.
| Compound Name | 2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 66606460 |
| Molecular Formula | C21H24BNO3 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-isoindol-1-one |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cccc1N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C21H24BNO3/c1-14-17(22-25-20(2,3)21(4,5)26-22)11-8-12-18(14)23-13-15-9-6-7-10-16(15)19(23)24/h6-12H,13H2,1-5H3 |
| InChIKey | DMCWSVXTTXEVOG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|