About (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile
(Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile (PubChem CID 66607051) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile |
| PubChem CID | 66607051 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile |
| SMILES | C/C(=C/C#N)N1CCCN(C)CC1 |
| InChI | InChI=1S/C10H17N3/c1-10(4-5-11)13-7-3-6-12(2)8-9-13/h4H,3,6-9H2,1-2H3/b10-4- |
| InChIKey | MLEWABOKJFCPRO-WMZJFQQLSA-N |
| XLogP | 1.05 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile?
The IUPAC name of (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile (CID 66607051) is (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile.
What is the SMILES notation for (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile?
The canonical SMILES for (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile is C/C(=C/C#N)N1CCCN(C)CC1.
What is the InChIKey of (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile?
The InChIKey is MLEWABOKJFCPRO-WMZJFQQLSA-N. The full InChI is InChI=1S/C10H17N3/c1-10(4-5-11)13-7-3-6-12(2)8-9-13/h4H,3,6-9H2,1-2H3/b10-4-.
What are the key properties of (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile?
(Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile has a molecular weight of 179.27 g/mol, XLogP of 1.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile is sourced from PubChem (CID 66607051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).