C24H30BF3N2O3 — CID 66607126
3-benzyl-1-ethyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 66607126) has the molecular formula C24H30BF3N2O3 and a molecular weight of 462.32 g/mol. Its IUPAC name is 3-benzyl-1-ethyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 3-benzyl-1-ethyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 66607126 |
| Molecular Formula | C24H30BF3N2O3 |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 3-benzyl-1-ethyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H30BF3N2O3/c1-6-30(21(31)29-15-17-10-8-7-9-11-17)16-18-14-19(24(26,27)28)12-13-20(18)25-32-22(2,3)23(4,5)33-25/h7-14H,6,15-16H2,1-5H3,(H,29,31) |
| InChIKey | CNVKBXFTUHCQQS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|