C18H26BF3N2O3 — CID 66607138
1-ethyl-3-methyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 66607138) has the molecular formula C18H26BF3N2O3 and a molecular weight of 386.22 g/mol. Its IUPAC name is 1-ethyl-3-methyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-methyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 66607138 |
| Molecular Formula | C18H26BF3N2O3 |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-ethyl-3-methyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1)C(=O)NC |
| InChI | InChI=1S/C18H26BF3N2O3/c1-7-24(15(25)23-6)11-12-10-13(18(20,21)22)8-9-14(12)19-26-16(2,3)17(4,5)27-19/h8-10H,7,11H2,1-6H3,(H,23,25) |
| InChIKey | GBUCNZOWTRTDKY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|