About 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one
2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one (PubChem CID 66607160) has the molecular formula C19H16O4
and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one.
Molecular Properties
| Compound Name | 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one |
| PubChem CID | 66607160 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one |
| SMILES | CCC#COc1ccc2oc3c(C)c(C)ccc3c(=O)c2c1O |
| InChI | InChI=1S/C19H16O4/c1-4-5-10-22-15-9-8-14-16(18(15)21)17(20)13-7-6-11(2)12(3)19(13)23-14/h6-9,21H,4H2,1-3H3 |
| InChIKey | UYTDBKKUTOSDHJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one?
The IUPAC name of 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one (CID 66607160) is 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one.
What is the SMILES notation for 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one?
The canonical SMILES for 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one is CCC#COc1ccc2oc3c(C)c(C)ccc3c(=O)c2c1O.
What is the InChIKey of 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one?
The InChIKey is UYTDBKKUTOSDHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O4/c1-4-5-10-22-15-9-8-14-16(18(15)21)17(20)13-7-6-11(2)12(3)19(13)23-14/h6-9,21H,4H2,1-3H3.
What are the key properties of 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one?
2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one has a molecular weight of 308.33 g/mol, XLogP of 4.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-1-ynoxy-1-hydroxy-5,6-dimethylxanthen-9-one is sourced from PubChem (CID 66607160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).