C23H27BF3NO3 — CID 66607577
N-ethyl-N-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 66607577) has the molecular formula C23H27BF3NO3 and a molecular weight of 433.28 g/mol. Its IUPAC name is N-ethyl-N-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | N-ethyl-N-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 66607577 |
| Molecular Formula | C23H27BF3NO3 |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-ethyl-N-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H27BF3NO3/c1-6-28(20(29)16-10-8-7-9-11-16)15-17-14-18(23(25,26)27)12-13-19(17)24-30-21(2,3)22(4,5)31-24/h7-14H,6,15H2,1-5H3 |
| InChIKey | ZKQWWZFRVATCRM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|