C21H20ClFO5S — CID 66607936
(2S,3R,4R,5S,6R)-2-[3-[(5-chlorothiophen-2-yl)methyl]-4-fluoronaphthalen-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 66607936) has the molecular formula C21H20ClFO5S and a molecular weight of 438.90 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(5-chlorothiophen-2-yl)methyl]-4-fluoronaphthalen-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(5-chlorothiophen-2-yl)methyl]-4-fluoronaphthalen-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 66607936 |
| Molecular Formula | C21H20ClFO5S |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(5-chlorothiophen-2-yl)methyl]-4-fluoronaphthalen-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3ccc(Cl)s3)c(F)c3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H20ClFO5S/c22-16-6-5-11(29-16)7-10-8-14(12-3-1-2-4-13(12)17(10)23)21-20(27)19(26)18(25)15(9-24)28-21/h1-6,8,15,18-21,24-27H,7,9H2/t15-,18-,19+,20-,21+/m1/s1 |
| InChIKey | LDEAFQJLCGFNRB-GRARQNNCSA-N |
| XLogP | 2.80 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |