C31H32FNO9S — CID 66608496
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate (PubChem CID 66608496) has the molecular formula C31H32FNO9S and a molecular weight of 613.66 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66608496 |
| Molecular Formula | C31H32FNO9S |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(-c4ccc(F)nc4)s3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H32FNO9S/c1-16-6-7-21(12-23(16)13-24-9-10-26(43-24)22-8-11-27(32)33-14-22)28-30(40-19(4)36)31(41-20(5)37)29(39-18(3)35)25(42-28)15-38-17(2)34/h6-12,14,25,28-31H,13,15H2,1-5H3/t25-,28+,29-,30+,31+/m1/s1 |
| InChIKey | YZVDHHNCJDVNHD-BYSLLSDESA-N |
| XLogP | 4.65 |
| TPSA | 127.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|