About 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile
3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile (PubChem CID 66608502) has the molecular formula C10H7FN4
and a molecular weight of 202.19 g/mol. Its IUPAC name is 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile |
| PubChem CID | 66608502 |
| Molecular Formula | C10H7FN4 |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile |
| SMILES | Cc1ncn(-c2ccc(C#N)cc2F)n1 |
| InChI | InChI=1S/C10H7FN4/c1-7-13-6-15(14-7)10-3-2-8(5-12)4-9(10)11/h2-4,6H,1H3 |
| InChIKey | ZNLOUZJPDIWQHK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile?
The IUPAC name of 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile (CID 66608502) is 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile.
What is the SMILES notation for 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile?
The canonical SMILES for 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile is Cc1ncn(-c2ccc(C#N)cc2F)n1.
What is the InChIKey of 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile?
The InChIKey is ZNLOUZJPDIWQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN4/c1-7-13-6-15(14-7)10-3-2-8(5-12)4-9(10)11/h2-4,6H,1H3.
What are the key properties of 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile?
3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile has a molecular weight of 202.19 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)benzonitrile is sourced from PubChem (CID 66608502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).