C30H39ClIN5O3 — CID 66608626
1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;6-iodo-2-propoxy-3-propylquinazolin-4-one (PubChem CID 66608626) has the molecular formula C30H39ClIN5O3 and a molecular weight of 680.03 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;6-iodo-2-propoxy-3-propylquinazolin-4-one.
| Compound Name | 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;6-iodo-2-propoxy-3-propylquinazolin-4-one |
|---|---|
| PubChem CID | 66608626 |
| Molecular Formula | C30H39ClIN5O3 |
| Molecular Weight | 680.03 g/mol |
| Exact Mass | 679.18 |
| IUPAC Name | 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;6-iodo-2-propoxy-3-propylquinazolin-4-one |
| SMILES | CC(C)(C)C(O)(CCc1ccc(Cl)cc1)Cn1cncn1.CCCOc1nc2ccc(I)cc2c(=O)n1CCC |
| InChI | InChI=1S/C16H22ClN3O.C14H17IN2O2/c1-15(2,3)16(21,10-20-12-18-11-19-20)9-8-13-4-6-14(17)7-5-13;1-3-7-17-13(18)11-9-10(15)5-6-12(11)16-14(17)19-8-4-2/h4-7,11-12,21H,8-10H2,1-3H3;5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | WABMCAHBNVIPDN-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.03 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|