About 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide
4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide (PubChem CID 66608815) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide.
Molecular Properties
| Compound Name | 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide |
| PubChem CID | 66608815 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide |
| SMILES | C=CC(N)CCC(=O)O.NC(=O)N1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C15H12N2O.C6H11NO2/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17;1-2-5(7)3-4-6(8)9/h1-10H,(H2,16,18);2,5H,1,3-4,7H2,(H,8,9) |
| InChIKey | NJOZRWYRUKLADY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide?
The IUPAC name of 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide (CID 66608815) is 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide.
What is the SMILES notation for 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide?
The canonical SMILES for 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide is C=CC(N)CCC(=O)O.NC(=O)N1c2ccccc2C=Cc2ccccc21.
What is the InChIKey of 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide?
The InChIKey is NJOZRWYRUKLADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O.C6H11NO2/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17;1-2-5(7)3-4-6(8)9/h1-10H,(H2,16,18);2,5H,1,3-4,7H2,(H,8,9).
What are the key properties of 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide?
4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide has a molecular weight of 365.43 g/mol, XLogP of 3.75, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminohex-5-enoic acid;benzo[b][1]benzazepine-11-carboxamide is sourced from PubChem (CID 66608815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).