About benzhydrylbenzene;3H-2-benzofuran-1-one
benzhydrylbenzene;3H-2-benzofuran-1-one (PubChem CID 66609148) has the molecular formula C27H22O2
and a molecular weight of 378.47 g/mol. Its IUPAC name is benzhydrylbenzene;3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | benzhydrylbenzene;3H-2-benzofuran-1-one |
| PubChem CID | 66609148 |
| Molecular Formula | C27H22O2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | benzhydrylbenzene;3H-2-benzofuran-1-one |
| SMILES | O=C1OCc2ccccc21.c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16.C8H6O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-8-7-4-2-1-3-6(7)5-10-8/h1-15,19H;1-4H,5H2 |
| InChIKey | VHNFAQLOVBWGGB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylbenzene;3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylbenzene;3H-2-benzofuran-1-one?
The IUPAC name of benzhydrylbenzene;3H-2-benzofuran-1-one (CID 66609148) is benzhydrylbenzene;3H-2-benzofuran-1-one.
What is the SMILES notation for benzhydrylbenzene;3H-2-benzofuran-1-one?
The canonical SMILES for benzhydrylbenzene;3H-2-benzofuran-1-one is O=C1OCc2ccccc21.c1ccc(C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzhydrylbenzene;3H-2-benzofuran-1-one?
The InChIKey is VHNFAQLOVBWGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16.C8H6O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-8-7-4-2-1-3-6(7)5-10-8/h1-15,19H;1-4H,5H2.
What are the key properties of benzhydrylbenzene;3H-2-benzofuran-1-one?
benzhydrylbenzene;3H-2-benzofuran-1-one has a molecular weight of 378.47 g/mol, XLogP of 6.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylbenzene;3H-2-benzofuran-1-one is sourced from PubChem (CID 66609148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).