C12H12N3O3P — CID 666098
N-(3-oxo-2,4-dihydro-1,5,3lambda5-benzodioxaphosphepin-3-yl)pyrimidin-2-amine (PubChem CID 666098) has the molecular formula C12H12N3O3P and a molecular weight of 277.22 g/mol. Its IUPAC name is N-(3-oxo-2,4-dihydro-1,5,3lambda5-benzodioxaphosphepin-3-yl)pyrimidin-2-amine.
| Compound Name | N-(3-oxo-2,4-dihydro-1,5,3lambda5-benzodioxaphosphepin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 666098 |
| Molecular Formula | C12H12N3O3P |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | N-(3-oxo-2,4-dihydro-1,5,3lambda5-benzodioxaphosphepin-3-yl)pyrimidin-2-amine |
| SMILES | O=P1(Nc2ncccn2)COc2ccccc2OC1 |
| InChI | InChI=1S/C12H12N3O3P/c16-19(15-12-13-6-3-7-14-12)8-17-10-4-1-2-5-11(10)18-9-19/h1-7H,8-9H2,(H,13,14,15,16) |
| InChIKey | LKALWFVKIDDOPJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|