C19H17N3O3S — CID 66610067
1-[4-(benzenesulfonyl)phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66610067) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-(benzenesulfonyl)phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66610067 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1-[4-(benzenesulfonyl)phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17N3O3S/c23-19(21-14-15-5-4-12-20-13-15)22-16-8-10-18(11-9-16)26(24,25)17-6-2-1-3-7-17/h1-13H,14H2,(H2,21,22,23) |
| InChIKey | SJMQTTISZPIKBR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |