C12H12F3N3O2S2 — CID 66610638
N-[2-[5-(4-aminophenyl)-1,3-thiazol-2-yl]ethyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 66610638) has the molecular formula C12H12F3N3O2S2 and a molecular weight of 351.38 g/mol. Its IUPAC name is N-[2-[5-(4-aminophenyl)-1,3-thiazol-2-yl]ethyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[5-(4-aminophenyl)-1,3-thiazol-2-yl]ethyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 66610638 |
| Molecular Formula | C12H12F3N3O2S2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[2-[5-(4-aminophenyl)-1,3-thiazol-2-yl]ethyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | Nc1ccc(-c2cnc(CCNS(=O)(=O)C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C12H12F3N3O2S2/c13-12(14,15)22(19,20)18-6-5-11-17-7-10(21-11)8-1-3-9(16)4-2-8/h1-4,7,18H,5-6,16H2 |
| InChIKey | ZXPNIXGWUCSRAN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|