C33H33F3N8O3 — CID 66611083
4-[5-(1-amino-2,2,2-trifluoroethyl)-2-[(6-methoxy-3-pyridinyl)amino]-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine (PubChem CID 66611083) has the molecular formula C33H33F3N8O3 and a molecular weight of 646.67 g/mol. Its IUPAC name is 4-[5-(1-amino-2,2,2-trifluoroethyl)-2-[(6-methoxy-3-pyridinyl)amino]-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[5-(1-amino-2,2,2-trifluoroethyl)-2-[(6-methoxy-3-pyridinyl)amino]-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 66611083 |
| Molecular Formula | C33H33F3N8O3 |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | 4-[5-(1-amino-2,2,2-trifluoroethyl)-2-[(6-methoxy-3-pyridinyl)amino]-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nc(C)nc(-c3cc(C(N)C(F)(F)F)cnc3Nc3ccc(OC)nc3)n2)cc1 |
| InChI | InChI=1S/C33H33F3N8O3/c1-20-40-31(27-15-23(29(37)33(34,35)36)16-39-30(27)42-24-9-14-28(47-4)38-17-24)43-32(41-20)44(18-21-5-10-25(45-2)11-6-21)19-22-7-12-26(46-3)13-8-22/h5-17,29H,18-19,37H2,1-4H3,(H,39,42) |
| InChIKey | ANHCYTPDVHGIHV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |