C11H11NO — CID 66611208
1,3,4,4a-tetrahydropyrano[3,4-b]indole (PubChem CID 66611208) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is 1,3,4,4a-tetrahydropyrano[3,4-b]indole.
| Compound Name | 1,3,4,4a-tetrahydropyrano[3,4-b]indole |
|---|---|
| PubChem CID | 66611208 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 1,3,4,4a-tetrahydropyrano[3,4-b]indole |
| SMILES | c1ccc2c(c1)N=C1COCCC12 |
| InChI | InChI=1S/C11H11NO/c1-2-4-10-8(3-1)9-5-6-13-7-11(9)12-10/h1-4,9H,5-7H2 |
| InChIKey | SVQCZHOYIDFGAH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |