About 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine
6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine (PubChem CID 66611486) has the molecular formula C19H20FN5O3
and a molecular weight of 385.40 g/mol. Its IUPAC name is 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine.
Molecular Properties
| Compound Name | 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine |
| PubChem CID | 66611486 |
| Molecular Formula | C19H20FN5O3 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine |
| SMILES | Cc1nc(-c2cc(C3OCCO3)cnc2F)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C19H20FN5O3/c1-11-23-15(13-8-12(9-21-17(13)20)19-27-6-7-28-19)16-18(24-11)25(10-22-16)14-4-2-3-5-26-14/h8-10,14,19H,2-7H2,1H3 |
| InChIKey | BBBWTFPCPFJWNM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine?
The IUPAC name of 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine (CID 66611486) is 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine.
What is the SMILES notation for 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine?
The canonical SMILES for 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine is Cc1nc(-c2cc(C3OCCO3)cnc2F)c2ncn(C3CCCCO3)c2n1.
What is the InChIKey of 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine?
The InChIKey is BBBWTFPCPFJWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN5O3/c1-11-23-15(13-8-12(9-21-17(13)20)19-27-6-7-28-19)16-18(24-11)25(10-22-16)14-4-2-3-5-26-14/h8-10,14,19H,2-7H2,1H3.
What are the key properties of 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine?
6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine has a molecular weight of 385.40 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(1,3-dioxolan-2-yl)-2-fluoro-3-pyridinyl]-2-methyl-9-(oxan-2-yl)purine is sourced from PubChem (CID 66611486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).