C20H16N2O4 — CID 666115
3-(2-methoxyethyl)-2-phenylchromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 666115) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-2-phenylchromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 3-(2-methoxyethyl)-2-phenylchromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 666115 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3-(2-methoxyethyl)-2-phenylchromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | COCCn1c(-c2ccccc2)nc2oc3ccccc3c(=O)c2c1=O |
| InChI | InChI=1S/C20H16N2O4/c1-25-12-11-22-18(13-7-3-2-4-8-13)21-19-16(20(22)24)17(23)14-9-5-6-10-15(14)26-19/h2-10H,11-12H2,1H3 |
| InChIKey | LIHRWPRKDSGLTB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|