C9H10N4O — CID 66612183
N-(aminomethyl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 66612183) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is N-(aminomethyl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-(aminomethyl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66612183 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-(aminomethyl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | NCNC(=O)c1cn2ccccc2n1 |
| InChI | InChI=1S/C9H10N4O/c10-6-11-9(14)7-5-13-4-2-1-3-8(13)12-7/h1-5H,6,10H2,(H,11,14) |
| InChIKey | KHZQGVDNOQANRQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|