C26H23FN4O3 — CID 66612229
(E)-3-[4-amino-7-cyclopentyl-5-(2-fluoro-4-phenoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-6-yl]prop-2-enoic acid (PubChem CID 66612229) has the molecular formula C26H23FN4O3 and a molecular weight of 458.49 g/mol. Its IUPAC name is (E)-3-[4-amino-7-cyclopentyl-5-(2-fluoro-4-phenoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-6-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-amino-7-cyclopentyl-5-(2-fluoro-4-phenoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66612229 |
| Molecular Formula | C26H23FN4O3 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (E)-3-[4-amino-7-cyclopentyl-5-(2-fluoro-4-phenoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-6-yl]prop-2-enoic acid |
| SMILES | Nc1ncnn2c(C3CCCC3)c(/C=C/C(=O)O)c(-c3ccc(Oc4ccccc4)cc3F)c12 |
| InChI | InChI=1S/C26H23FN4O3/c27-21-14-18(34-17-8-2-1-3-9-17)10-11-19(21)23-20(12-13-22(32)33)24(16-6-4-5-7-16)31-25(23)26(28)29-15-30-31/h1-3,8-16H,4-7H2,(H,32,33)(H2,28,29,30)/b13-12+ |
| InChIKey | PXHTXCJRFAQARE-OUKQBFOZSA-N |
| XLogP | 5.67 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|