C10H11N3O2S — CID 66612740
4-[6-(1,2,3,6-tetrahydropyridin-4-yl)-2-pyridinyl]-1,3,2,4-dioxathiazetidine (PubChem CID 66612740) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-[6-(1,2,3,6-tetrahydropyridin-4-yl)-2-pyridinyl]-1,3,2,4-dioxathiazetidine.
| Compound Name | 4-[6-(1,2,3,6-tetrahydropyridin-4-yl)-2-pyridinyl]-1,3,2,4-dioxathiazetidine |
|---|---|
| PubChem CID | 66612740 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-[6-(1,2,3,6-tetrahydropyridin-4-yl)-2-pyridinyl]-1,3,2,4-dioxathiazetidine |
| SMILES | C1=C(c2cccc(N3OSO3)n2)CCNC1 |
| InChI | InChI=1S/C10H11N3O2S/c1-2-9(8-4-6-11-7-5-8)12-10(3-1)13-14-16-15-13/h1-4,11H,5-7H2 |
| InChIKey | GGVCKVBVFWMEHC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|