About (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine
(2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine (PubChem CID 66612926) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine.
Molecular Properties
| Compound Name | (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine |
| PubChem CID | 66612926 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine |
| SMILES | CN1CCC[C@H]1CC1=CC=CCC1 |
| InChI | InChI=1S/C12H19N/c1-13-9-5-8-12(13)10-11-6-3-2-4-7-11/h2-3,6,12H,4-5,7-10H2,1H3/t12-/m0/s1 |
| InChIKey | JOYBNXJDTNLFNB-LBPRGKRZSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine?
The IUPAC name of (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine (CID 66612926) is (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine.
What is the SMILES notation for (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine?
The canonical SMILES for (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine is CN1CCC[C@H]1CC1=CC=CCC1.
What is the InChIKey of (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine?
The InChIKey is JOYBNXJDTNLFNB-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H19N/c1-13-9-5-8-12(13)10-11-6-3-2-4-7-11/h2-3,6,12H,4-5,7-10H2,1H3/t12-/m0/s1.
What are the key properties of (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine?
(2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine has a molecular weight of 177.29 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(cyclohexa-1,3-dien-1-ylmethyl)-1-methylpyrrolidine is sourced from PubChem (CID 66612926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).