About (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine
(2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine (PubChem CID 66612967) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine.
Molecular Properties
| Compound Name | (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine |
| PubChem CID | 66612967 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine |
| SMILES | CC[C@@H](C)NCC1C=CSC1 |
| InChI | InChI=1S/C9H17NS/c1-3-8(2)10-6-9-4-5-11-7-9/h4-5,8-10H,3,6-7H2,1-2H3/t8-,9?/m1/s1 |
| InChIKey | FCNRRQUMUVZVPD-VEDVMXKPSA-N |
| XLogP | 2.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine?
The IUPAC name of (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine (CID 66612967) is (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine.
What is the SMILES notation for (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine?
The canonical SMILES for (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine is CC[C@@H](C)NCC1C=CSC1.
What is the InChIKey of (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine?
The InChIKey is FCNRRQUMUVZVPD-VEDVMXKPSA-N. The full InChI is InChI=1S/C9H17NS/c1-3-8(2)10-6-9-4-5-11-7-9/h4-5,8-10H,3,6-7H2,1-2H3/t8-,9?/m1/s1.
What are the key properties of (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine?
(2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine has a molecular weight of 171.31 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(2,3-dihydrothiophen-3-ylmethyl)butan-2-amine is sourced from PubChem (CID 66612967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).