About methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate
methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate (PubChem CID 66613192) has the molecular formula C18H26N4O2S
and a molecular weight of 362.50 g/mol. Its IUPAC name is methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate |
| PubChem CID | 66613192 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C(C)(C)C)cc1NC1CCC(n2cncn2)CC1 |
| InChI | InChI=1S/C18H26N4O2S/c1-18(2,3)15-9-14(16(25-15)17(23)24-4)21-12-5-7-13(8-6-12)22-11-19-10-20-22/h9-13,21H,5-8H2,1-4H3 |
| InChIKey | PGDLSJXNEBEOMT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate?
The IUPAC name of methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate (CID 66613192) is methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate is COC(=O)c1sc(C(C)(C)C)cc1NC1CCC(n2cncn2)CC1.
What is the InChIKey of methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate?
The InChIKey is PGDLSJXNEBEOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4O2S/c1-18(2,3)15-9-14(16(25-15)17(23)24-4)21-12-5-7-13(8-6-12)22-11-19-10-20-22/h9-13,21H,5-8H2,1-4H3.
What are the key properties of methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate?
methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate has a molecular weight of 362.50 g/mol, XLogP of 4.02, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-tert-butyl-3-[[4-(1,2,4-triazol-1-yl)cyclohexyl]amino]thiophene-2-carboxylate is sourced from PubChem (CID 66613192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).