C25H28Cl2N2O4 — CID 66613620
bis[(5R)-7-chloro-5-methyl-1,2,3,4-tetrahydro-3-benzazepin-5-yl] propanedioate (PubChem CID 66613620) has the molecular formula C25H28Cl2N2O4 and a molecular weight of 491.42 g/mol. Its IUPAC name is bis[(5R)-7-chloro-5-methyl-1,2,3,4-tetrahydro-3-benzazepin-5-yl] propanedioate.
| Compound Name | bis[(5R)-7-chloro-5-methyl-1,2,3,4-tetrahydro-3-benzazepin-5-yl] propanedioate |
|---|---|
| PubChem CID | 66613620 |
| Molecular Formula | C25H28Cl2N2O4 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | bis[(5R)-7-chloro-5-methyl-1,2,3,4-tetrahydro-3-benzazepin-5-yl] propanedioate |
| SMILES | C[C@]1(OC(=O)CC(=O)O[C@@]2(C)CNCCc3ccc(Cl)cc32)CNCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H28Cl2N2O4/c1-24(14-28-9-7-16-3-5-18(26)11-20(16)24)32-22(30)13-23(31)33-25(2)15-29-10-8-17-4-6-19(27)12-21(17)25/h3-6,11-12,28-29H,7-10,13-15H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | AEFMYRWKOPSDNZ-DQEYMECFSA-N |
| XLogP | 3.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|