About [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol
[3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol (PubChem CID 66614254) has the molecular formula C19H17ClF2N2O2
and a molecular weight of 378.81 g/mol. Its IUPAC name is [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol.
Molecular Properties
| Compound Name | [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol |
| PubChem CID | 66614254 |
| Molecular Formula | C19H17ClF2N2O2 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol |
| SMILES | COc1ccc(C(O)c2c(Cl)nn(C)c2-c2c(F)cccc2F)c(C)c1 |
| InChI | InChI=1S/C19H17ClF2N2O2/c1-10-9-11(26-3)7-8-12(10)18(25)16-17(24(2)23-19(16)20)15-13(21)5-4-6-14(15)22/h4-9,18,25H,1-3H3 |
| InChIKey | UCJPRVMPGXIWKT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol?
The IUPAC name of [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol (CID 66614254) is [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol.
What is the SMILES notation for [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol?
The canonical SMILES for [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol is COc1ccc(C(O)c2c(Cl)nn(C)c2-c2c(F)cccc2F)c(C)c1.
What is the InChIKey of [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol?
The InChIKey is UCJPRVMPGXIWKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClF2N2O2/c1-10-9-11(26-3)7-8-12(10)18(25)16-17(24(2)23-19(16)20)15-13(21)5-4-6-14(15)22/h4-9,18,25H,1-3H3.
What are the key properties of [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol?
[3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol has a molecular weight of 378.81 g/mol, XLogP of 4.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-5-(2,6-difluorophenyl)-1-methylpyrazol-4-yl]-(4-methoxy-2-methylphenyl)methanol is sourced from PubChem (CID 66614254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).