C10H11N3 — CID 66614275
3,5,7,9a-tetrahydro-2H-imidazo[4,5-c]quinoline (PubChem CID 66614275) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 3,5,7,9a-tetrahydro-2H-imidazo[4,5-c]quinoline.
| Compound Name | 3,5,7,9a-tetrahydro-2H-imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 66614275 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 3,5,7,9a-tetrahydro-2H-imidazo[4,5-c]quinoline |
| SMILES | C1=CC2C(=CC1)NC=C1NCN=C12 |
| InChI | InChI=1S/C10H11N3/c1-2-4-8-7(3-1)10-9(5-11-8)12-6-13-10/h1,3-5,7,11-12H,2,6H2 |
| InChIKey | DJIJSOKQVADRKS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|