About 4-iodo-2-propoxypyridine
4-iodo-2-propoxypyridine (PubChem CID 66614410) has the molecular formula C8H10INO
and a molecular weight of 263.08 g/mol. Its IUPAC name is 4-iodo-2-propoxypyridine.
Molecular Properties
| Compound Name | 4-iodo-2-propoxypyridine |
| PubChem CID | 66614410 |
| Molecular Formula | C8H10INO |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 4-iodo-2-propoxypyridine |
| SMILES | CCCOc1cc(I)ccn1 |
| InChI | InChI=1S/C8H10INO/c1-2-5-11-8-6-7(9)3-4-10-8/h3-4,6H,2,5H2,1H3 |
| InChIKey | HEBNLYZZBJXABK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-2-propoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-2-propoxypyridine?
The IUPAC name of 4-iodo-2-propoxypyridine (CID 66614410) is 4-iodo-2-propoxypyridine.
What is the SMILES notation for 4-iodo-2-propoxypyridine?
The canonical SMILES for 4-iodo-2-propoxypyridine is CCCOc1cc(I)ccn1.
What is the InChIKey of 4-iodo-2-propoxypyridine?
The InChIKey is HEBNLYZZBJXABK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10INO/c1-2-5-11-8-6-7(9)3-4-10-8/h3-4,6H,2,5H2,1H3.
What are the key properties of 4-iodo-2-propoxypyridine?
4-iodo-2-propoxypyridine has a molecular weight of 263.08 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-2-propoxypyridine is sourced from PubChem (CID 66614410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).