C24H33NO2 — CID 66614610
2,2,6,6-tetramethyl-1-(1-phenyl-2-phenylmethoxyethoxy)piperidine (PubChem CID 66614610) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(1-phenyl-2-phenylmethoxyethoxy)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-(1-phenyl-2-phenylmethoxyethoxy)piperidine |
|---|---|
| PubChem CID | 66614610 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(1-phenyl-2-phenylmethoxyethoxy)piperidine |
| SMILES | CC1(C)CCCC(C)(C)N1OC(COCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33NO2/c1-23(2)16-11-17-24(3,4)25(23)27-22(21-14-9-6-10-15-21)19-26-18-20-12-7-5-8-13-20/h5-10,12-15,22H,11,16-19H2,1-4H3 |
| InChIKey | SIXBZTAYSXAYBD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |