About 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one
2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one (PubChem CID 66615397) has the molecular formula C20H21Cl2N3O2
and a molecular weight of 406.31 g/mol. Its IUPAC name is 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one |
| PubChem CID | 66615397 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one |
| SMILES | CO[C@@H](CNCc1ccc(Cl)c(Cl)c1)CNc1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C20H21Cl2N3O2/c1-27-14(11-23-10-13-6-7-16(21)17(22)8-13)12-24-20-9-19(26)15-4-2-3-5-18(15)25-20/h2-9,14,23H,10-12H2,1H3,(H2,24,25,26)/t14-/m0/s1 |
| InChIKey | XGGXACSDTFCKOL-AWEZNQCLSA-N |
| XLogP | 4.05 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one?
The IUPAC name of 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one (CID 66615397) is 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one.
What is the SMILES notation for 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one?
The canonical SMILES for 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one is CO[C@@H](CNCc1ccc(Cl)c(Cl)c1)CNc1cc(=O)c2ccccc2[nH]1.
What is the InChIKey of 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one?
The InChIKey is XGGXACSDTFCKOL-AWEZNQCLSA-N. The full InChI is InChI=1S/C20H21Cl2N3O2/c1-27-14(11-23-10-13-6-7-16(21)17(22)8-13)12-24-20-9-19(26)15-4-2-3-5-18(15)25-20/h2-9,14,23H,10-12H2,1H3,(H2,24,25,26)/t14-/m0/s1.
What are the key properties of 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one?
2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one has a molecular weight of 406.31 g/mol, XLogP of 4.05, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-3-[(3,4-dichlorophenyl)methylamino]-2-methoxypropyl]amino]-1H-quinolin-4-one is sourced from PubChem (CID 66615397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).